C12H20N2O2 — CID 23358639
4,4-diamino-5-butylocta-1,7-diene-3,6-dione (PubChem CID 23358639) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4,4-diamino-5-butylocta-1,7-diene-3,6-dione.
| Compound Name | 4,4-diamino-5-butylocta-1,7-diene-3,6-dione |
|---|---|
| PubChem CID | 23358639 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 4,4-diamino-5-butylocta-1,7-diene-3,6-dione |
| SMILES | C=CC(=O)C(CCCC)C(N)(N)C(=O)C=C |
| InChI | InChI=1S/C12H20N2O2/c1-4-7-8-9(10(15)5-2)12(13,14)11(16)6-3/h5-6,9H,2-4,7-8,13-14H2,1H3 |
| InChIKey | KCPUDCHGITUBNQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|