C20H38O5 — CID 152681291
4-(1,1,1,2-tetramethoxypentan-2-yl)undec-1-en-3-one (PubChem CID 152681291) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is 4-(1,1,1,2-tetramethoxypentan-2-yl)undec-1-en-3-one.
| Compound Name | 4-(1,1,1,2-tetramethoxypentan-2-yl)undec-1-en-3-one |
|---|---|
| PubChem CID | 152681291 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 4-(1,1,1,2-tetramethoxypentan-2-yl)undec-1-en-3-one |
| SMILES | C=CC(=O)C(CCCCCCC)C(CCC)(OC)C(OC)(OC)OC |
| InChI | InChI=1S/C20H38O5/c1-8-11-12-13-14-15-17(18(21)10-3)19(22-4,16-9-2)20(23-5,24-6)25-7/h10,17H,3,8-9,11-16H2,1-2,4-7H3 |
| InChIKey | ZNPDEVHXRIYHJJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|