C27H36N4O4 — CID 23359662
2-[5-[4-[5-(diaminomethylideneamino)pentoxy]phenyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetic acid (PubChem CID 23359662) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[5-[4-[5-(diaminomethylideneamino)pentoxy]phenyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetic acid.
| Compound Name | 2-[5-[4-[5-(diaminomethylideneamino)pentoxy]phenyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 23359662 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 2-[5-[4-[5-(diaminomethylideneamino)pentoxy]phenyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetic acid |
| SMILES | NC(N)=NCCCCCOc1ccc(C2CC(CC(=O)O)C(=O)N2CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H36N4O4/c28-27(29)30-15-5-2-6-17-35-23-13-11-21(12-14-23)24-18-22(19-25(32)33)26(34)31(24)16-7-10-20-8-3-1-4-9-20/h1,3-4,8-9,11-14,22,24H,2,5-7,10,15-19H2,(H,32,33)(H4,28,29,30) |
| InChIKey | HLLDKYNPIKSVRW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|