C26H38O3PS2+ — CID 23361437
bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium (PubChem CID 23361437) has the molecular formula C26H38O3PS2+ and a molecular weight of 493.70 g/mol. Its IUPAC name is bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium.
| Compound Name | bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium |
|---|---|
| PubChem CID | 23361437 |
| Molecular Formula | C26H38O3PS2+ |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium |
| SMILES | CC(C)C(O[P+](=O)OC(Sc1ccccc1)(C(C)C)C(C)C)(Sc1ccccc1)C(C)C |
| InChI | InChI=1S/C26H38O3PS2/c1-19(2)25(20(3)4,31-23-15-11-9-12-16-23)28-30(27)29-26(21(5)6,22(7)8)32-24-17-13-10-14-18-24/h9-22H,1-8H3/q+1 |
| InChIKey | PBLMOCSISPDWHD-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|