About bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium
bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium (PubChem CID 23361437) has the molecular formula C26H38O3PS2+
and a molecular weight of 493.70 g/mol. Its IUPAC name is bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium.
Molecular Properties
| Compound Name | bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium |
| PubChem CID | 23361437 |
| Molecular Formula | C26H38O3PS2+ |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium |
| SMILES | CC(C)C(O[P+](=O)OC(Sc1ccccc1)(C(C)C)C(C)C)(Sc1ccccc1)C(C)C |
| InChI | InChI=1S/C26H38O3PS2/c1-19(2)25(20(3)4,31-23-15-11-9-12-16-23)28-30(27)29-26(21(5)6,22(7)8)32-24-17-13-10-14-18-24/h9-22H,1-8H3/q+1 |
| InChIKey | PBLMOCSISPDWHD-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium?
The IUPAC name of bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium (CID 23361437) is bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium.
What is the SMILES notation for bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium?
The canonical SMILES for bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium is CC(C)C(O[P+](=O)OC(Sc1ccccc1)(C(C)C)C(C)C)(Sc1ccccc1)C(C)C.
What is the InChIKey of bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium?
The InChIKey is PBLMOCSISPDWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H38O3PS2/c1-19(2)25(20(3)4,31-23-15-11-9-12-16-23)28-30(27)29-26(21(5)6,22(7)8)32-24-17-13-10-14-18-24/h9-22H,1-8H3/q+1.
What are the key properties of bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium?
bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium has a molecular weight of 493.70 g/mol, XLogP of 9.28, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2,4-dimethyl-3-phenylsulfanylpentan-3-yl)oxy]-oxophosphanium is sourced from PubChem (CID 23361437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).