C22H21N3O4S2 — CID 23362810
ethyl 5-[2-(naphthalen-1-ylsulfonylamino)ethylsulfanyl]imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 23362810) has the molecular formula C22H21N3O4S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is ethyl 5-[2-(naphthalen-1-ylsulfonylamino)ethylsulfanyl]imidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 5-[2-(naphthalen-1-ylsulfonylamino)ethylsulfanyl]imidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 23362810 |
| Molecular Formula | C22H21N3O4S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | ethyl 5-[2-(naphthalen-1-ylsulfonylamino)ethylsulfanyl]imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cn2c(SCCNS(=O)(=O)c3cccc4ccccc34)cccc2n1 |
| InChI | InChI=1S/C22H21N3O4S2/c1-2-29-22(26)18-15-25-20(24-18)11-6-12-21(25)30-14-13-23-31(27,28)19-10-5-8-16-7-3-4-9-17(16)19/h3-12,15,23H,2,13-14H2,1H3 |
| InChIKey | CBVGWUYTXDWQAT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|