About 2-ethenylideneindole
2-ethenylideneindole (PubChem CID 23363330) has the molecular formula C10H7N
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-ethenylideneindole.
Molecular Properties
| Compound Name | 2-ethenylideneindole |
| PubChem CID | 23363330 |
| Molecular Formula | C10H7N |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2-ethenylideneindole |
| SMILES | C=C=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C10H7N/c1-2-9-7-8-5-3-4-6-10(8)11-9/h3-7H,1H2 |
| InChIKey | CTGPEJMNMKXVAP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenylideneindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylideneindole?
The IUPAC name of 2-ethenylideneindole (CID 23363330) is 2-ethenylideneindole.
What is the SMILES notation for 2-ethenylideneindole?
The canonical SMILES for 2-ethenylideneindole is C=C=C1C=c2ccccc2=N1.
What is the InChIKey of 2-ethenylideneindole?
The InChIKey is CTGPEJMNMKXVAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N/c1-2-9-7-8-5-3-4-6-10(8)11-9/h3-7H,1H2.
What are the key properties of 2-ethenylideneindole?
2-ethenylideneindole has a molecular weight of 141.17 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylideneindole is sourced from PubChem (CID 23363330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).