C26H22F6N2O5Si2 — CID 23368896
1-[3-[[[3-(2,5-dioxopyrrol-1-yl)-5-(trifluoromethyl)phenyl]-dimethylsilyl]oxy-dimethylsilyl]-5-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 23368896) has the molecular formula C26H22F6N2O5Si2 and a molecular weight of 612.63 g/mol. Its IUPAC name is 1-[3-[[[3-(2,5-dioxopyrrol-1-yl)-5-(trifluoromethyl)phenyl]-dimethylsilyl]oxy-dimethylsilyl]-5-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-[[[3-(2,5-dioxopyrrol-1-yl)-5-(trifluoromethyl)phenyl]-dimethylsilyl]oxy-dimethylsilyl]-5-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 23368896 |
| Molecular Formula | C26H22F6N2O5Si2 |
| Molecular Weight | 612.63 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | 1-[3-[[[3-(2,5-dioxopyrrol-1-yl)-5-(trifluoromethyl)phenyl]-dimethylsilyl]oxy-dimethylsilyl]-5-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | C[Si](C)(O[Si](C)(C)c1cc(N2C(=O)C=CC2=O)cc(C(F)(F)F)c1)c1cc(N2C(=O)C=CC2=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H22F6N2O5Si2/c1-40(2,19-11-15(25(27,28)29)9-17(13-19)33-21(35)5-6-22(33)36)39-41(3,4)20-12-16(26(30,31)32)10-18(14-20)34-23(37)7-8-24(34)38/h5-14H,1-4H3 |
| InChIKey | NOPBSALEDQRJBI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|