C21H18FNO6S — CID 23370409
dimethyl 3-(4-fluorophenyl)-4-(5-methylsulfonyl-2-pyridinyl)cyclopenta-2,4-diene-1,1-dicarboxylate (PubChem CID 23370409) has the molecular formula C21H18FNO6S and a molecular weight of 431.44 g/mol. Its IUPAC name is dimethyl 3-(4-fluorophenyl)-4-(5-methylsulfonyl-2-pyridinyl)cyclopenta-2,4-diene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(4-fluorophenyl)-4-(5-methylsulfonyl-2-pyridinyl)cyclopenta-2,4-diene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 23370409 |
| Molecular Formula | C21H18FNO6S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | dimethyl 3-(4-fluorophenyl)-4-(5-methylsulfonyl-2-pyridinyl)cyclopenta-2,4-diene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=C(c2ccc(F)cc2)C(c2ccc(S(C)(=O)=O)cn2)=C1 |
| InChI | InChI=1S/C21H18FNO6S/c1-28-19(24)21(20(25)29-2)10-16(13-4-6-14(22)7-5-13)17(11-21)18-9-8-15(12-23-18)30(3,26)27/h4-12H,1-3H3 |
| InChIKey | SDNNQIMTHAMANB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|