C17H15N3O5 — CID 23373197
1-[(1,3-dioxoinden-2-ylidene)amino]-3-(3-methoxyphenyl)urea;hydrate (PubChem CID 23373197) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is 1-[(1,3-dioxoinden-2-ylidene)amino]-3-(3-methoxyphenyl)urea;hydrate.
| Compound Name | 1-[(1,3-dioxoinden-2-ylidene)amino]-3-(3-methoxyphenyl)urea;hydrate |
|---|---|
| PubChem CID | 23373197 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-[(1,3-dioxoinden-2-ylidene)amino]-3-(3-methoxyphenyl)urea;hydrate |
| SMILES | COc1cccc(NC(=O)NN=c2c(=O)c3ccccc3c2=O)c1.O |
| InChI | InChI=1S/C17H13N3O4.H2O/c1-24-11-6-4-5-10(9-11)18-17(23)20-19-14-15(21)12-7-2-3-8-13(12)16(14)22;/h2-9H,1H3,(H2,18,20,23);1H2 |
| InChIKey | GJWURQNPKZRVLC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|