C16H11N3O4 — CID 67710095
N-[(5-methoxy-1,3-dioxoinden-2-ylidene)amino]pyridine-4-carboxamide (PubChem CID 67710095) has the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. Its IUPAC name is N-[(5-methoxy-1,3-dioxoinden-2-ylidene)amino]pyridine-4-carboxamide.
| Compound Name | N-[(5-methoxy-1,3-dioxoinden-2-ylidene)amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 67710095 |
| Molecular Formula | C16H11N3O4 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-[(5-methoxy-1,3-dioxoinden-2-ylidene)amino]pyridine-4-carboxamide |
| SMILES | COc1ccc2c(=O)c(=NNC(=O)c3ccncc3)c(=O)c2c1 |
| InChI | InChI=1S/C16H11N3O4/c1-23-10-2-3-11-12(8-10)15(21)13(14(11)20)18-19-16(22)9-4-6-17-7-5-9/h2-8H,1H3,(H,19,22) |
| InChIKey | MXNWNLLWIFDXND-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|