C15H9FN4O3 — CID 67801204
1-[(5-fluoro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea (PubChem CID 67801204) has the molecular formula C15H9FN4O3 and a molecular weight of 312.26 g/mol. Its IUPAC name is 1-[(5-fluoro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea.
| Compound Name | 1-[(5-fluoro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea |
|---|---|
| PubChem CID | 67801204 |
| Molecular Formula | C15H9FN4O3 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 1-[(5-fluoro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea |
| SMILES | O=C(NN=c1c(=O)c2ccc(F)cc2c1=O)Nc1ccncc1 |
| InChI | InChI=1S/C15H9FN4O3/c16-8-1-2-10-11(7-8)14(22)12(13(10)21)19-20-15(23)18-9-3-5-17-6-4-9/h1-7H,(H2,17,18,20,23) |
| InChIKey | RJMQHYVGGZQSRC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|