C16H9F2N3O3 — CID 23373153
1-(2,4-difluorophenyl)-3-[(1,3-dioxoinden-2-ylidene)amino]urea (PubChem CID 23373153) has the molecular formula C16H9F2N3O3 and a molecular weight of 329.26 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(1,3-dioxoinden-2-ylidene)amino]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(1,3-dioxoinden-2-ylidene)amino]urea |
|---|---|
| PubChem CID | 23373153 |
| Molecular Formula | C16H9F2N3O3 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(1,3-dioxoinden-2-ylidene)amino]urea |
| SMILES | O=C(NN=c1c(=O)c2ccccc2c1=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H9F2N3O3/c17-8-5-6-12(11(18)7-8)19-16(24)21-20-13-14(22)9-3-1-2-4-10(9)15(13)23/h1-7H,(H2,19,21,24) |
| InChIKey | FXDQFYXSXRWFFC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|