C21H40N2O — CID 23374292
3-N,3-N,4-N,4-N-tetrabutyl-2H-pyran-3,4-diamine (PubChem CID 23374292) has the molecular formula C21H40N2O and a molecular weight of 336.56 g/mol. Its IUPAC name is 3-N,3-N,4-N,4-N-tetrabutyl-2H-pyran-3,4-diamine.
| Compound Name | 3-N,3-N,4-N,4-N-tetrabutyl-2H-pyran-3,4-diamine |
|---|---|
| PubChem CID | 23374292 |
| Molecular Formula | C21H40N2O |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.31 |
| IUPAC Name | 3-N,3-N,4-N,4-N-tetrabutyl-2H-pyran-3,4-diamine |
| SMILES | CCCCN(CCCC)C1=C(N(CCCC)CCCC)COC=C1 |
| InChI | InChI=1S/C21H40N2O/c1-5-9-14-22(15-10-6-2)20-13-18-24-19-21(20)23(16-11-7-3)17-12-8-4/h13,18H,5-12,14-17,19H2,1-4H3 |
| InChIKey | RDXXUXJUXOORNX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |