C14H27NO — CID 144557215
5,6-bis(ethenyl)-4-ethyl-2,3-dihydro-1,4-oxazine;ethane (PubChem CID 144557215) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-4-ethyl-2,3-dihydro-1,4-oxazine;ethane.
| Compound Name | 5,6-bis(ethenyl)-4-ethyl-2,3-dihydro-1,4-oxazine;ethane |
|---|---|
| PubChem CID | 144557215 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 5,6-bis(ethenyl)-4-ethyl-2,3-dihydro-1,4-oxazine;ethane |
| SMILES | C=CC1=C(C=C)N(CC)CCO1.CC.CC |
| InChI | InChI=1S/C10H15NO.2C2H6/c1-4-9-10(5-2)12-8-7-11(9)6-3;2*1-2/h4-5H,1-2,6-8H2,3H3;2*1-2H3 |
| InChIKey | AFYQGGQWFDLVKI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |