C8H13N3O2 — CID 2337561
4,6-diethoxypyrimidin-2-amine (PubChem CID 2337561) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4,6-diethoxypyrimidin-2-amine.
| Compound Name | 4,6-diethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 2337561 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4,6-diethoxypyrimidin-2-amine |
| SMILES | CCOc1cc(OCC)nc(N)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-3-12-6-5-7(13-4-2)11-8(9)10-6/h5H,3-4H2,1-2H3,(H2,9,10,11) |
| InChIKey | MWLFJSYZFRVWBS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |