C9H8F12O2S — CID 23377173
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-8-methylsulfonyloctane (PubChem CID 23377173) has the molecular formula C9H8F12O2S and a molecular weight of 408.20 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-8-methylsulfonyloctane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-8-methylsulfonyloctane |
|---|---|
| PubChem CID | 23377173 |
| Molecular Formula | C9H8F12O2S |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-8-methylsulfonyloctane |
| SMILES | CS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H8F12O2S/c1-24(22,23)3-2-5(12,13)7(16,17)9(20,21)8(18,19)6(14,15)4(10)11/h4H,2-3H2,1H3 |
| InChIKey | SSZBVYQEEYEYKW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|