C27H21N5O4 — CID 2337754
3-nitro-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)benzo[h]chromen-2-ylidene]benzamide (PubChem CID 2337754) has the molecular formula C27H21N5O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is 3-nitro-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)benzo[h]chromen-2-ylidene]benzamide.
| Compound Name | 3-nitro-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)benzo[h]chromen-2-ylidene]benzamide |
|---|---|
| PubChem CID | 2337754 |
| Molecular Formula | C27H21N5O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-nitro-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)benzo[h]chromen-2-ylidene]benzamide |
| SMILES | O=C(/N=c1\oc2c(ccc3ccccc32)cc1-c1nnc2n1CCCCC2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H21N5O4/c33-26(19-8-6-9-20(15-19)32(34)35)28-27-22(25-30-29-23-11-2-1-5-14-31(23)25)16-18-13-12-17-7-3-4-10-21(17)24(18)36-27/h3-4,6-10,12-13,15-16H,1-2,5,11,14H2/b28-27- |
| InChIKey | BKVBRHVATSSGDZ-DQSJHHFOSA-N |
| XLogP | 5.22 |
| TPSA | 116.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|