About ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate
ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate (PubChem CID 23378580) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate.
Analyze ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate?
The IUPAC name of ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate (CID 23378580) is ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate.
What is the SMILES notation for ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate?
The canonical SMILES for ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate is CCOC(=O)COC1CCCN=C1N.
What is the InChIKey of ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate?
The InChIKey is PKNMEVWUZDHHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c1-2-13-8(12)6-14-7-4-3-5-11-9(7)10/h7H,2-6H2,1H3,(H2,10,11).
What are the key properties of ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate?
ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate has a molecular weight of 200.24 g/mol, XLogP of 0.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(6-amino-2,3,4,5-tetrahydropyridin-5-yl)oxy]acetate is sourced from PubChem (CID 23378580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).