C7H11F4NO2 — CID 23379718
2-(1,1-difluoropropoxy)-N-ethyl-2,2-difluoroacetamide (PubChem CID 23379718) has the molecular formula C7H11F4NO2 and a molecular weight of 217.16 g/mol. Its IUPAC name is 2-(1,1-difluoropropoxy)-N-ethyl-2,2-difluoroacetamide.
| Compound Name | 2-(1,1-difluoropropoxy)-N-ethyl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 23379718 |
| Molecular Formula | C7H11F4NO2 |
| Molecular Weight | 217.16 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-(1,1-difluoropropoxy)-N-ethyl-2,2-difluoroacetamide |
| SMILES | CCNC(=O)C(F)(F)OC(F)(F)CC |
| InChI | InChI=1S/C7H11F4NO2/c1-3-6(8,9)14-7(10,11)5(13)12-4-2/h3-4H2,1-2H3,(H,12,13) |
| InChIKey | UPDIMKUNEAYLQW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |