C16H21NO4S — CID 2338053
[2-(cyclopentylamino)-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate (PubChem CID 2338053) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 2338053 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate |
| SMILES | COc1cc(SC)ccc1C(=O)OCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H21NO4S/c1-20-14-9-12(22-2)7-8-13(14)16(19)21-10-15(18)17-11-5-3-4-6-11/h7-9,11H,3-6,10H2,1-2H3,(H,17,18) |
| InChIKey | ULZUQZOMLKUYJZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |