C13H21Y — CID 23381602
carbanide;1,2,3,4,5-pentamethylbenzene-6-ide;yttrium(3+) (PubChem CID 23381602) has the molecular formula C13H21Y and a molecular weight of 266.22 g/mol. Its IUPAC name is carbanide;1,2,3,4,5-pentamethylbenzene-6-ide;yttrium(3+).
| Compound Name | carbanide;1,2,3,4,5-pentamethylbenzene-6-ide;yttrium(3+) |
|---|---|
| PubChem CID | 23381602 |
| Molecular Formula | C13H21Y |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | carbanide;1,2,3,4,5-pentamethylbenzene-6-ide;yttrium(3+) |
| SMILES | Cc1[c-]c(C)c(C)c(C)c1C.[CH3-].[CH3-].[Y+3] |
| InChI | InChI=1S/C11H15.2CH3.Y/c1-7-6-8(2)10(4)11(5)9(7)3;;;/h1-5H3;2*1H3;/q3*-1;+3 |
| InChIKey | XQKYUWRCJIIBTN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|