C38H26F8N2O7 — CID 23382054
2-methyl-5-[2-[4-methyl-3-[2,2,3,3,4,4,5,5-octafluoro-6-(4-methylphenoxy)hexoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione (PubChem CID 23382054) has the molecular formula C38H26F8N2O7 and a molecular weight of 774.62 g/mol. Its IUPAC name is 2-methyl-5-[2-[4-methyl-3-[2,2,3,3,4,4,5,5-octafluoro-6-(4-methylphenoxy)hexoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[2-[4-methyl-3-[2,2,3,3,4,4,5,5-octafluoro-6-(4-methylphenoxy)hexoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23382054 |
| Molecular Formula | C38H26F8N2O7 |
| Molecular Weight | 774.62 g/mol |
| Exact Mass | 774.16 |
| IUPAC Name | 2-methyl-5-[2-[4-methyl-3-[2,2,3,3,4,4,5,5-octafluoro-6-(4-methylphenoxy)hexoxy]phenyl]-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COc2cc(N3C(=O)c4ccc(C(=O)c5ccc6c(c5)C(=O)N(C)C6=O)cc4C3=O)ccc2C)cc1 |
| InChI | InChI=1S/C38H26F8N2O7/c1-19-4-10-24(11-5-19)54-17-35(39,40)37(43,44)38(45,46)36(41,42)18-55-29-16-23(9-6-20(29)2)48-33(52)26-13-8-22(15-28(26)34(48)53)30(49)21-7-12-25-27(14-21)32(51)47(3)31(25)50/h4-16H,17-18H2,1-3H3 |
| InChIKey | KGRYECWGYJFMTA-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|