sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate

C24H13N2NaOS2 — CID 23382135

IUPACsodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate
SMILES[Na+].[O-]c1cc2ccc(-c3nc4ccccc4s3)cc2cc1-c1nc2ccccc2s1
InChIInChI=1S/C24H14N2OS2.Na/c27-20-13-14-9-10-15(23-25-18-5-1-3-7-21(18)28-23)11-16(14)12-17(20)24-26-19-6-2-4-8-22(19)29-24;/h1-13,27H;/q;+1/p-1
InChIKeyOFYQMIQYJGDYIA-UHFFFAOYSA-M
MW432.51 g/mol
LogP3.47
Rot. Bonds2

About sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate

sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate (PubChem CID 23382135) has the molecular formula C24H13N2NaOS2 and a molecular weight of 432.51 g/mol. Its IUPAC name is sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate.

Molecular Properties

Compound Namesodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate
PubChem CID23382135
Molecular FormulaC24H13N2NaOS2
Molecular Weight432.51 g/mol
Exact Mass432.04
IUPAC Namesodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate
SMILES[Na+].[O-]c1cc2ccc(-c3nc4ccccc4s3)cc2cc1-c1nc2ccccc2s1
InChIInChI=1S/C24H14N2OS2.Na/c27-20-13-14-9-10-15(23-25-18-5-1-3-7-21(18)28-23)11-16(14)12-17(20)24-26-19-6-2-4-8-22(19)29-24;/h1-13,27H;/q;+1/p-1
InChIKeyOFYQMIQYJGDYIA-UHFFFAOYSA-M
XLogP3.47
TPSA48.84 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms30
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500432.51
LogP ≤ 53.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate?
The IUPAC name of sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate (CID 23382135) is sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate.
What is the SMILES notation for sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate?
The canonical SMILES for sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate is [Na+].[O-]c1cc2ccc(-c3nc4ccccc4s3)cc2cc1-c1nc2ccccc2s1.
What is the InChIKey of sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate?
The InChIKey is OFYQMIQYJGDYIA-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H14N2OS2.Na/c27-20-13-14-9-10-15(23-25-18-5-1-3-7-21(18)28-23)11-16(14)12-17(20)24-26-19-6-2-4-8-22(19)29-24;/h1-13,27H;/q;+1/p-1.
What are the key properties of sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate?
sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate has a molecular weight of 432.51 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate is sourced from PubChem (CID 23382135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).