C24H13N2NaOS2 — CID 23382135
sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate (PubChem CID 23382135) has the molecular formula C24H13N2NaOS2 and a molecular weight of 432.51 g/mol. Its IUPAC name is sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate.
| Compound Name | sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate |
|---|---|
| PubChem CID | 23382135 |
| Molecular Formula | C24H13N2NaOS2 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | sodium 3,6-bis(1,3-benzothiazol-2-yl)naphthalen-2-olate |
| SMILES | [Na+].[O-]c1cc2ccc(-c3nc4ccccc4s3)cc2cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H14N2OS2.Na/c27-20-13-14-9-10-15(23-25-18-5-1-3-7-21(18)28-23)11-16(14)12-17(20)24-26-19-6-2-4-8-22(19)29-24;/h1-13,27H;/q;+1/p-1 |
| InChIKey | OFYQMIQYJGDYIA-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 48.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |