C37H44N8O5 — CID 23383638
4-[4-[4-[4-[[2-(2,4-dimethylphenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(3-hydroxybutan-2-yl)-1,2,4-triazol-3-one (PubChem CID 23383638) has the molecular formula C37H44N8O5 and a molecular weight of 680.81 g/mol. Its IUPAC name is 4-[4-[4-[4-[[2-(2,4-dimethylphenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(3-hydroxybutan-2-yl)-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[2-(2,4-dimethylphenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(3-hydroxybutan-2-yl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 23383638 |
| Molecular Formula | C37H44N8O5 |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | 4-[4-[4-[4-[[2-(2,4-dimethylphenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(3-hydroxybutan-2-yl)-1,2,4-triazol-3-one |
| SMILES | Cc1ccc(C2(Cn3cncn3)OCC(COc3ccc(N4CCN(c5ccc(-n6cnn(C(C)C(C)O)c6=O)cc5)CC4)cc3)O2)c(C)c1 |
| InChI | InChI=1S/C37H44N8O5/c1-26-5-14-35(27(2)19-26)37(22-43-24-38-23-39-43)49-21-34(50-37)20-48-33-12-10-31(11-13-33)42-17-15-41(16-18-42)30-6-8-32(9-7-30)44-25-40-45(36(44)47)28(3)29(4)46/h5-14,19,23-25,28-29,34,46H,15-18,20-22H2,1-4H3 |
| InChIKey | PIDKFSJMEYKXHD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|