C14H24OS — CID 23384652
1-[3-ethenyl-4-(1-ethylsulfanylpropan-2-yl)cyclopentyl]ethanone (PubChem CID 23384652) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is 1-[3-ethenyl-4-(1-ethylsulfanylpropan-2-yl)cyclopentyl]ethanone.
| Compound Name | 1-[3-ethenyl-4-(1-ethylsulfanylpropan-2-yl)cyclopentyl]ethanone |
|---|---|
| PubChem CID | 23384652 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-[3-ethenyl-4-(1-ethylsulfanylpropan-2-yl)cyclopentyl]ethanone |
| SMILES | C=CC1CC(C(C)=O)CC1C(C)CSCC |
| InChI | InChI=1S/C14H24OS/c1-5-12-7-13(11(4)15)8-14(12)10(3)9-16-6-2/h5,10,12-14H,1,6-9H2,2-4H3 |
| InChIKey | FRYYTMHBUUWRAB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|