About (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene
(E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene (PubChem CID 23384790) has the molecular formula C7H10ClF3
and a molecular weight of 186.60 g/mol. Its IUPAC name is (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene.
Analyze (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene?
The IUPAC name of (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene (CID 23384790) is (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene.
What is the SMILES notation for (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene?
The canonical SMILES for (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene is C/C(=C(\Cl)C(F)(F)F)C(C)C.
What is the InChIKey of (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene?
The InChIKey is KXRYHPRIDUCUOS-AATRIKPKSA-N. The full InChI is InChI=1S/C7H10ClF3/c1-4(2)5(3)6(8)7(9,10)11/h4H,1-3H3/b6-5+.
What are the key properties of (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene?
(E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene has a molecular weight of 186.60 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene is sourced from PubChem (CID 23384790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).