C7H13F — CID 23384807
(E)-2-fluoro-3,4-dimethylpent-2-ene (PubChem CID 23384807) has the molecular formula C7H13F and a molecular weight of 116.18 g/mol. Its IUPAC name is (E)-2-fluoro-3,4-dimethylpent-2-ene.
| Compound Name | (E)-2-fluoro-3,4-dimethylpent-2-ene |
|---|---|
| PubChem CID | 23384807 |
| Molecular Formula | C7H13F |
| Molecular Weight | 116.18 g/mol |
| Exact Mass | 116.10 |
| IUPAC Name | (E)-2-fluoro-3,4-dimethylpent-2-ene |
| SMILES | C/C(F)=C(/C)C(C)C |
| InChI | InChI=1S/C7H13F/c1-5(2)6(3)7(4)8/h5H,1-4H3/b7-6+ |
| InChIKey | INCRIQICEXBXSX-VOTSOKGWSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |