About 3-Fluoro-2,4-dimethylpent-2-ene
3-Fluoro-2,4-dimethylpent-2-ene (PubChem CID 23384922) has the molecular formula C7H13F
and a molecular weight of 116.18 g/mol. Its IUPAC name is 3-fluoro-2,4-dimethylpent-2-ene.
Molecular Properties
| Compound Name | 3-Fluoro-2,4-dimethylpent-2-ene |
| PubChem CID | 23384922 |
| Molecular Formula | C7H13F |
| Molecular Weight | 116.18 g/mol |
| Exact Mass | 116.10 |
| IUPAC Name | 3-fluoro-2,4-dimethylpent-2-ene |
| SMILES | CC(C)C(=C(C)C)F |
| InChI | InChI=1S/C7H13F/c1-5(2)7(8)6(3)4/h5H,1-4H3 |
| InChIKey | NZSJXJJPLMNOFZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | 97 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-Fluoro-2,4-dimethylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Fluoro-2,4-dimethylpent-2-ene?
The IUPAC name of 3-Fluoro-2,4-dimethylpent-2-ene (CID 23384922) is 3-fluoro-2,4-dimethylpent-2-ene.
What is the SMILES notation for 3-Fluoro-2,4-dimethylpent-2-ene?
The canonical SMILES for 3-Fluoro-2,4-dimethylpent-2-ene is CC(C)C(=C(C)C)F.
What is the InChIKey of 3-Fluoro-2,4-dimethylpent-2-ene?
The InChIKey is NZSJXJJPLMNOFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F/c1-5(2)7(8)6(3)4/h5H,1-4H3.
What are the key properties of 3-Fluoro-2,4-dimethylpent-2-ene?
3-Fluoro-2,4-dimethylpent-2-ene has a molecular weight of 116.18 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Fluoro-2,4-dimethylpent-2-ene is sourced from PubChem (CID 23384922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).