C28H32N2O4 — CID 23385672
benzyl (2S)-6-amino-2-[benzyl(phenylmethoxycarbonyl)amino]hexanoate (PubChem CID 23385672) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is benzyl (2S)-6-amino-2-[benzyl(phenylmethoxycarbonyl)amino]hexanoate.
| Compound Name | benzyl (2S)-6-amino-2-[benzyl(phenylmethoxycarbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 23385672 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | benzyl (2S)-6-amino-2-[benzyl(phenylmethoxycarbonyl)amino]hexanoate |
| SMILES | NCCCC[C@@H](C(=O)OCc1ccccc1)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H32N2O4/c29-19-11-10-18-26(27(31)33-21-24-14-6-2-7-15-24)30(20-23-12-4-1-5-13-23)28(32)34-22-25-16-8-3-9-17-25/h1-9,12-17,26H,10-11,18-22,29H2/t26-/m0/s1 |
| InChIKey | UKOIYCYOWBTCFS-SANMLTNESA-N |
| XLogP | 5.07 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|