C44H44N2O3P2+2 — CID 23387094
[2-oxo-2-[2-[2-[(2-triphenylphosphaniumylacetyl)amino]ethoxy]ethylamino]ethyl]-triphenylphosphanium (PubChem CID 23387094) has the molecular formula C44H44N2O3P2+2 and a molecular weight of 710.79 g/mol. Its IUPAC name is [2-oxo-2-[2-[2-[(2-triphenylphosphaniumylacetyl)amino]ethoxy]ethylamino]ethyl]-triphenylphosphanium.
| Compound Name | [2-oxo-2-[2-[2-[(2-triphenylphosphaniumylacetyl)amino]ethoxy]ethylamino]ethyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 23387094 |
| Molecular Formula | C44H44N2O3P2+2 |
| Molecular Weight | 710.79 g/mol |
| Exact Mass | 710.28 |
| IUPAC Name | [2-oxo-2-[2-[2-[(2-triphenylphosphaniumylacetyl)amino]ethoxy]ethylamino]ethyl]-triphenylphosphanium |
| SMILES | O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NCCOCCNC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H42N2O3P2/c47-43(35-50(37-19-7-1-8-20-37,38-21-9-2-10-22-38)39-23-11-3-12-24-39)45-31-33-49-34-32-46-44(48)36-51(40-25-13-4-14-26-40,41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-30H,31-36H2/p+2 |
| InChIKey | JLWFYZUNKZVCNZ-UHFFFAOYSA-P |
| XLogP | 5.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.79 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|