C47H50N4O3P2+2 — CID 23387097
[2-oxo-2-[3-[3-[(2-triphenylphosphaniumylacetyl)amino]propylcarbamoylamino]propylamino]ethyl]-triphenylphosphanium (PubChem CID 23387097) has the molecular formula C47H50N4O3P2+2 and a molecular weight of 780.89 g/mol. Its IUPAC name is [2-oxo-2-[3-[3-[(2-triphenylphosphaniumylacetyl)amino]propylcarbamoylamino]propylamino]ethyl]-triphenylphosphanium.
| Compound Name | [2-oxo-2-[3-[3-[(2-triphenylphosphaniumylacetyl)amino]propylcarbamoylamino]propylamino]ethyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 23387097 |
| Molecular Formula | C47H50N4O3P2+2 |
| Molecular Weight | 780.89 g/mol |
| Exact Mass | 780.33 |
| IUPAC Name | [2-oxo-2-[3-[3-[(2-triphenylphosphaniumylacetyl)amino]propylcarbamoylamino]propylamino]ethyl]-triphenylphosphanium |
| SMILES | O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NCCCNC(=O)NCCCNC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H48N4O3P2/c52-45(37-55(39-21-7-1-8-22-39,40-23-9-2-10-24-40)41-25-11-3-12-26-41)48-33-19-35-50-47(54)51-36-20-34-49-46(53)38-56(42-27-13-4-14-28-42,43-29-15-5-16-30-43)44-31-17-6-18-32-44/h1-18,21-32H,19-20,33-38H2,(H2-2,48,49,50,51,52,53,54)/p+2 |
| InChIKey | JEPSPPVGISNDSB-UHFFFAOYSA-P |
| XLogP | 5.29 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|