C32H40N4O4P+ — CID 23387096
[2-oxo-2-[3-[[3-oxo-3-[3-(propanoylamino)propylamino]propanoyl]amino]propylamino]ethyl]-triphenylphosphanium (PubChem CID 23387096) has the molecular formula C32H40N4O4P+ and a molecular weight of 575.67 g/mol. Its IUPAC name is [2-oxo-2-[3-[[3-oxo-3-[3-(propanoylamino)propylamino]propanoyl]amino]propylamino]ethyl]-triphenylphosphanium.
| Compound Name | [2-oxo-2-[3-[[3-oxo-3-[3-(propanoylamino)propylamino]propanoyl]amino]propylamino]ethyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 23387096 |
| Molecular Formula | C32H40N4O4P+ |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | [2-oxo-2-[3-[[3-oxo-3-[3-(propanoylamino)propylamino]propanoyl]amino]propylamino]ethyl]-triphenylphosphanium |
| SMILES | CCC(=O)NCCCNC(=O)CC(=O)NCCCNC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H39N4O4P/c1-2-29(37)33-20-12-21-34-30(38)24-31(39)35-22-13-23-36-32(40)25-41(26-14-6-3-7-15-26,27-16-8-4-9-17-27)28-18-10-5-11-19-28/h3-11,14-19H,2,12-13,20-25H2,1H3,(H3-,33,34,35,36,37,38,39,40)/p+1 |
| InChIKey | RCVQHUVFKFFOCI-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|