C31H37N3O5P+ — CID 23386976
[2-[3-[carboxymethyl-[3-(propanoylamino)propanoyl]amino]propylamino]-2-oxoethyl]-triphenylphosphanium (PubChem CID 23386976) has the molecular formula C31H37N3O5P+ and a molecular weight of 562.63 g/mol. Its IUPAC name is [2-[3-[carboxymethyl-[3-(propanoylamino)propanoyl]amino]propylamino]-2-oxoethyl]-triphenylphosphanium.
| Compound Name | [2-[3-[carboxymethyl-[3-(propanoylamino)propanoyl]amino]propylamino]-2-oxoethyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 23386976 |
| Molecular Formula | C31H37N3O5P+ |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | [2-[3-[carboxymethyl-[3-(propanoylamino)propanoyl]amino]propylamino]-2-oxoethyl]-triphenylphosphanium |
| SMILES | CCC(=O)NCCC(=O)N(CCCNC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)O |
| InChI | InChI=1S/C31H36N3O5P/c1-2-28(35)33-21-19-30(37)34(23-31(38)39)22-12-20-32-29(36)24-40(25-13-6-3-7-14-25,26-15-8-4-9-16-26)27-17-10-5-11-18-27/h3-11,13-18H,2,12,19-24H2,1H3,(H2-,32,33,35,36,38,39)/p+1 |
| InChIKey | PLRZFSPTXGJNED-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|