C23H23ClNO4P — CID 21120641
[2-carboxy-2-(methoxycarbonylamino)ethyl]-triphenylphosphanium chloride (PubChem CID 21120641) has the molecular formula C23H23ClNO4P and a molecular weight of 443.87 g/mol. Its IUPAC name is [2-carboxy-2-(methoxycarbonylamino)ethyl]-triphenylphosphanium chloride.
| Compound Name | [2-carboxy-2-(methoxycarbonylamino)ethyl]-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 21120641 |
| Molecular Formula | C23H23ClNO4P |
| Molecular Weight | 443.87 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [2-carboxy-2-(methoxycarbonylamino)ethyl]-triphenylphosphanium chloride |
| SMILES | COC(=O)NC(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O.[Cl-] |
| InChI | InChI=1S/C23H22NO4P.ClH/c1-28-23(27)24-21(22(25)26)17-29(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-16,21H,17H2,1H3,(H-,24,25,26,27);1H |
| InChIKey | PKCGEZQHAGLTNU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.87 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|