C16H16N2O7 — CID 23394973
(3aS,4R,7S,7aR)-2-(2,5-dimethoxy-4-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 23394973) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is (3aS,4R,7S,7aR)-2-(2,5-dimethoxy-4-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4R,7S,7aR)-2-(2,5-dimethoxy-4-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 23394973 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (3aS,4R,7S,7aR)-2-(2,5-dimethoxy-4-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C16H16N2O7/c1-23-11-6-8(18(21)22)12(24-2)5-7(11)17-15(19)13-9-3-4-10(25-9)14(13)16(17)20/h5-6,9-10,13-14H,3-4H2,1-2H3/t9-,10+,13-,14+ |
| InChIKey | LNHMXYQKKRUGDC-IOQCUFBNSA-N |
| XLogP | 1.28 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|