C35H22F6N4O12 — CID 139771823
2-(2,5-dimethoxy-4-nitrophenyl)-5-[2-[2-(2,5-dimethoxy-4-nitrophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione (PubChem CID 139771823) has the molecular formula C35H22F6N4O12 and a molecular weight of 804.56 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-4-nitrophenyl)-5-[2-[2-(2,5-dimethoxy-4-nitrophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,5-dimethoxy-4-nitrophenyl)-5-[2-[2-(2,5-dimethoxy-4-nitrophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139771823 |
| Molecular Formula | C35H22F6N4O12 |
| Molecular Weight | 804.56 g/mol |
| Exact Mass | 804.11 |
| IUPAC Name | 2-(2,5-dimethoxy-4-nitrophenyl)-5-[2-[2-(2,5-dimethoxy-4-nitrophenyl)-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]isoindole-1,3-dione |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1N1C(=O)c2ccc(C(c3ccc4c(c3)C(=O)N(c3cc(OC)c([N+](=O)[O-])cc3OC)C4=O)(C(F)(F)F)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C35H22F6N4O12/c1-54-25-13-23(44(50)51)27(56-3)11-21(25)42-29(46)17-7-5-15(9-19(17)31(42)48)33(34(36,37)38,35(39,40)41)16-6-8-18-20(10-16)32(49)43(30(18)47)22-12-28(57-4)24(45(52)53)14-26(22)55-2/h5-14H,1-4H3 |
| InChIKey | NCLHISOKLQSJRM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 197.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|