C17H15ClN2O2S2 — CID 23397294
methyl 2-[(2-amino-5-chlorophenyl)-(1,3-benzothiazol-2-yl)methyl]sulfanylacetate (PubChem CID 23397294) has the molecular formula C17H15ClN2O2S2 and a molecular weight of 378.91 g/mol. Its IUPAC name is methyl 2-[(2-amino-5-chlorophenyl)-(1,3-benzothiazol-2-yl)methyl]sulfanylacetate.
| Compound Name | methyl 2-[(2-amino-5-chlorophenyl)-(1,3-benzothiazol-2-yl)methyl]sulfanylacetate |
|---|---|
| PubChem CID | 23397294 |
| Molecular Formula | C17H15ClN2O2S2 |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | methyl 2-[(2-amino-5-chlorophenyl)-(1,3-benzothiazol-2-yl)methyl]sulfanylacetate |
| SMILES | COC(=O)CSC(c1nc2ccccc2s1)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C17H15ClN2O2S2/c1-22-15(21)9-23-16(11-8-10(18)6-7-12(11)19)17-20-13-4-2-3-5-14(13)24-17/h2-8,16H,9,19H2,1H3 |
| InChIKey | PYIVAEJFYQJDOB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|