C19H22Cl2N2O2S — CID 23397199
2-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]sulfanyl-N-(3-methoxypropyl)acetamide (PubChem CID 23397199) has the molecular formula C19H22Cl2N2O2S and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]sulfanyl-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]sulfanyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 23397199 |
| Molecular Formula | C19H22Cl2N2O2S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]sulfanyl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSC(c1cc(Cl)ccc1N)c1ccccc1Cl |
| InChI | InChI=1S/C19H22Cl2N2O2S/c1-25-10-4-9-23-18(24)12-26-19(14-5-2-3-6-16(14)21)15-11-13(20)7-8-17(15)22/h2-3,5-8,11,19H,4,9-10,12,22H2,1H3,(H,23,24) |
| InChIKey | ITZYJOHVYQFGGX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|