C19H21Cl2N3O2S — CID 23397354
N-(2-acetamidoethyl)-2-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]sulfanylacetamide (PubChem CID 23397354) has the molecular formula C19H21Cl2N3O2S and a molecular weight of 426.37 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]sulfanylacetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]sulfanylacetamide |
|---|---|
| PubChem CID | 23397354 |
| Molecular Formula | C19H21Cl2N3O2S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]sulfanylacetamide |
| SMILES | CC(=O)NCCNC(=O)CSC(c1cc(Cl)ccc1N)c1ccccc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O2S/c1-12(25)23-8-9-24-18(26)11-27-19(14-4-2-3-5-16(14)21)15-10-13(20)6-7-17(15)22/h2-7,10,19H,8-9,11,22H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | TYAQRVHSAOAGRS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|