C18H21BrCl2N2O — CID 142893163
N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]-2-bromo-N-methylacetamide;ethane (PubChem CID 142893163) has the molecular formula C18H21BrCl2N2O and a molecular weight of 432.19 g/mol. Its IUPAC name is N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]-2-bromo-N-methylacetamide;ethane.
| Compound Name | N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]-2-bromo-N-methylacetamide;ethane |
|---|---|
| PubChem CID | 142893163 |
| Molecular Formula | C18H21BrCl2N2O |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]-2-bromo-N-methylacetamide;ethane |
| SMILES | CC.CN(C(=O)CBr)C(c1cc(Cl)ccc1N)c1ccccc1Cl |
| InChI | InChI=1S/C16H15BrCl2N2O.C2H6/c1-21(15(22)9-17)16(11-4-2-3-5-13(11)19)12-8-10(18)6-7-14(12)20;1-2/h2-8,16H,9,20H2,1H3;1-2H3 |
| InChIKey | QPCLNAXYUHZNIJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|