C21H29Cl2N3O2 — CID 10971964
N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 10971964) has the molecular formula C21H29Cl2N3O2 and a molecular weight of 426.39 g/mol. Its IUPAC name is N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 10971964 |
| Molecular Formula | C21H29Cl2N3O2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[(2-amino-5-chlorophenyl)-(2-chlorophenyl)methyl]-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | COCCN(CCNC(c1cc(Cl)ccc1N)c1ccccc1Cl)CCOC |
| InChI | InChI=1S/C21H29Cl2N3O2/c1-27-13-11-26(12-14-28-2)10-9-25-21(17-5-3-4-6-19(17)23)18-15-16(22)7-8-20(18)24/h3-8,15,21,25H,9-14,24H2,1-2H3 |
| InChIKey | BJCXJZPFXQTAFP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|