C28H14N2O10S2 — CID 23399415
5,12,20,27-tetraoxo-2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(30),3(16),4(13),6(11),7,9,14,18,21,23,25,28-dodecaene-8,30-disulfonic acid (PubChem CID 23399415) has the molecular formula C28H14N2O10S2 and a molecular weight of 602.56 g/mol. Its IUPAC name is 5,12,20,27-tetraoxo-2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(30),3(16),4(13),6(11),7,9,14,18,21,23,25,28-dodecaene-8,30-disulfonic acid.
| Compound Name | 5,12,20,27-tetraoxo-2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(30),3(16),4(13),6(11),7,9,14,18,21,23,25,28-dodecaene-8,30-disulfonic acid |
|---|---|
| PubChem CID | 23399415 |
| Molecular Formula | C28H14N2O10S2 |
| Molecular Weight | 602.56 g/mol |
| Exact Mass | 602.01 |
| IUPAC Name | 5,12,20,27-tetraoxo-2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(30),3(16),4(13),6(11),7,9,14,18,21,23,25,28-dodecaene-8,30-disulfonic acid |
| SMILES | O=c1c2ccc(S(=O)(=O)O)cc2c(=O)c2c1ccc1[nH]c3c([nH]c12)c(S(=O)(=O)O)cc1c(=O)c2ccccc2c(=O)c13 |
| InChI | InChI=1S/C28H14N2O10S2/c31-25-14-6-5-11(41(35,36)37)9-16(14)28(34)20-15(25)7-8-18-22(20)30-23-19(42(38,39)40)10-17-21(24(23)29-18)27(33)13-4-2-1-3-12(13)26(17)32/h1-10,29-30H,(H,35,36,37)(H,38,39,40) |
| InChIKey | IYUQVVZJINEPDC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 208.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|