C54H48N6S3 — CID 23399525
2-[4-[3,5-bis[2,3,5,6-tetramethyl-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-2,3,5,6-tetramethylphenyl]-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 23399525) has the molecular formula C54H48N6S3 and a molecular weight of 877.22 g/mol. Its IUPAC name is 2-[4-[3,5-bis[2,3,5,6-tetramethyl-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-2,3,5,6-tetramethylphenyl]-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-[4-[3,5-bis[2,3,5,6-tetramethyl-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-2,3,5,6-tetramethylphenyl]-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 23399525 |
| Molecular Formula | C54H48N6S3 |
| Molecular Weight | 877.22 g/mol |
| Exact Mass | 876.31 |
| IUPAC Name | 2-[4-[3,5-bis[2,3,5,6-tetramethyl-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]phenyl]-2,3,5,6-tetramethylphenyl]-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Cc1c(C)c(-c2nc3cccnc3s2)c(C)c(C)c1-c1cc(-c2c(C)c(C)c(-c3nc4cccnc4s3)c(C)c2C)cc(-c2c(C)c(C)c(-c3nc4cccnc4s3)c(C)c2C)c1 |
| InChI | InChI=1S/C54H48N6S3/c1-25-31(7)46(52-58-40-16-13-19-55-49(40)61-52)32(8)26(2)43(25)37-22-38(44-27(3)33(9)47(34(10)28(44)4)53-59-41-17-14-20-56-50(41)62-53)24-39(23-37)45-29(5)35(11)48(36(12)30(45)6)54-60-42-18-15-21-57-51(42)63-54/h13-24H,1-12H3 |
| InChIKey | YDBWHWIGRDBMGW-UHFFFAOYSA-N |
| XLogP | 15.40 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.22 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |