C9H10N2S — CID 23400541
3-isothiocyanato-N,5-dimethylaniline (PubChem CID 23400541) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 3-isothiocyanato-N,5-dimethylaniline.
| Compound Name | 3-isothiocyanato-N,5-dimethylaniline |
|---|---|
| PubChem CID | 23400541 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-isothiocyanato-N,5-dimethylaniline |
| SMILES | CNc1cc(C)cc(N=C=S)c1 |
| InChI | InChI=1S/C9H10N2S/c1-7-3-8(10-2)5-9(4-7)11-6-12/h3-5,10H,1-2H3 |
| InChIKey | PCCTVIXXTGTZIV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|