About 3-isothiocyanato-N,5-dimethylaniline
3-isothiocyanato-N,5-dimethylaniline (PubChem CID 23400541) has the molecular formula C9H10N2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is 3-isothiocyanato-N,5-dimethylaniline.
Molecular Properties
| Compound Name | 3-isothiocyanato-N,5-dimethylaniline |
| PubChem CID | 23400541 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-isothiocyanato-N,5-dimethylaniline |
| SMILES | CNc1cc(C)cc(N=C=S)c1 |
| InChI | InChI=1S/C9H10N2S/c1-7-3-8(10-2)5-9(4-7)11-6-12/h3-5,10H,1-2H3 |
| InChIKey | PCCTVIXXTGTZIV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-isothiocyanato-N,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isothiocyanato-N,5-dimethylaniline?
The IUPAC name of 3-isothiocyanato-N,5-dimethylaniline (CID 23400541) is 3-isothiocyanato-N,5-dimethylaniline.
What is the SMILES notation for 3-isothiocyanato-N,5-dimethylaniline?
The canonical SMILES for 3-isothiocyanato-N,5-dimethylaniline is CNc1cc(C)cc(N=C=S)c1.
What is the InChIKey of 3-isothiocyanato-N,5-dimethylaniline?
The InChIKey is PCCTVIXXTGTZIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S/c1-7-3-8(10-2)5-9(4-7)11-6-12/h3-5,10H,1-2H3.
What are the key properties of 3-isothiocyanato-N,5-dimethylaniline?
3-isothiocyanato-N,5-dimethylaniline has a molecular weight of 178.26 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isothiocyanato-N,5-dimethylaniline is sourced from PubChem (CID 23400541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).