About 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide
3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide (PubChem CID 23401042) has the molecular formula C16H14N4O2S
and a molecular weight of 326.38 g/mol. Its IUPAC name is 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide.
Molecular Properties
| Compound Name | 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide |
| PubChem CID | 23401042 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2)c2c(N)c(C(N)=O)sc2n1 |
| InChI | InChI=1S/C16H14N4O2S/c1-8-7-10(15(22)20-9-5-3-2-4-6-9)11-12(17)13(14(18)21)23-16(11)19-8/h2-7H,17H2,1H3,(H2,18,21)(H,20,22) |
| InChIKey | FCQGANJIDHJKBX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide?
The IUPAC name of 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide (CID 23401042) is 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide.
What is the SMILES notation for 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide?
The canonical SMILES for 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide is Cc1cc(C(=O)Nc2ccccc2)c2c(N)c(C(N)=O)sc2n1.
What is the InChIKey of 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide?
The InChIKey is FCQGANJIDHJKBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O2S/c1-8-7-10(15(22)20-9-5-3-2-4-6-9)11-12(17)13(14(18)21)23-16(11)19-8/h2-7H,17H2,1H3,(H2,18,21)(H,20,22).
What are the key properties of 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide?
3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide has a molecular weight of 326.38 g/mol, XLogP of 2.54, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-methyl-4-N-phenylthieno[2,3-b]pyridine-2,4-dicarboxamide is sourced from PubChem (CID 23401042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).