C17H18N6O3S2 — CID 170908748
3-amino-N-[4-(diaminomethylideneamino)sulfonylphenyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 170908748) has the molecular formula C17H18N6O3S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 3-amino-N-[4-(diaminomethylideneamino)sulfonylphenyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[4-(diaminomethylideneamino)sulfonylphenyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 170908748 |
| Molecular Formula | C17H18N6O3S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 3-amino-N-[4-(diaminomethylideneamino)sulfonylphenyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c2c(N)c(C(=O)Nc3ccc(S(=O)(=O)N=C(N)N)cc3)sc2n1 |
| InChI | InChI=1S/C17H18N6O3S2/c1-8-7-9(2)21-16-12(8)13(18)14(27-16)15(24)22-10-3-5-11(6-4-10)28(25,26)23-17(19)20/h3-7H,18H2,1-2H3,(H,22,24)(H4,19,20,23) |
| InChIKey | YXNNYNFLQPXFQF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 166.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|