C15H15N2O3+ — CID 2340347
[2-(4-methylphenyl)-2-oxoethyl] 2-aminopyridin-1-ium-3-carboxylate (PubChem CID 2340347) has the molecular formula C15H15N2O3+ and a molecular weight of 271.30 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 2-aminopyridin-1-ium-3-carboxylate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 2-aminopyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 2340347 |
| Molecular Formula | C15H15N2O3+ |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 2-aminopyridin-1-ium-3-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc[nH+]c2N)cc1 |
| InChI | InChI=1S/C15H14N2O3/c1-10-4-6-11(7-5-10)13(18)9-20-15(19)12-3-2-8-17-14(12)16/h2-8H,9H2,1H3,(H2,16,17)/p+1 |
| InChIKey | LURFVAAYWURJOK-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |