C14H23F3O2 — CID 23405327
4-ethenyl-1-(1-propoxyethoxy)-1-(trifluoromethyl)cyclohexane (PubChem CID 23405327) has the molecular formula C14H23F3O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-ethenyl-1-(1-propoxyethoxy)-1-(trifluoromethyl)cyclohexane.
| Compound Name | 4-ethenyl-1-(1-propoxyethoxy)-1-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 23405327 |
| Molecular Formula | C14H23F3O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-ethenyl-1-(1-propoxyethoxy)-1-(trifluoromethyl)cyclohexane |
| SMILES | C=CC1CCC(OC(C)OCCC)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H23F3O2/c1-4-10-18-11(3)19-13(14(15,16)17)8-6-12(5-2)7-9-13/h5,11-12H,2,4,6-10H2,1,3H3 |
| InChIKey | OYPYRBNXXFOZKQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|