C29H45F9O3 — CID 23405403
2-[4-[4-[4-(1-butoxyethoxy)-4-(trifluoromethyl)cyclohexyl]hexan-2-yl]-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 23405403) has the molecular formula C29H45F9O3 and a molecular weight of 612.66 g/mol. Its IUPAC name is 2-[4-[4-[4-(1-butoxyethoxy)-4-(trifluoromethyl)cyclohexyl]hexan-2-yl]-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[4-[4-(1-butoxyethoxy)-4-(trifluoromethyl)cyclohexyl]hexan-2-yl]-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 23405403 |
| Molecular Formula | C29H45F9O3 |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | 2-[4-[4-[4-(1-butoxyethoxy)-4-(trifluoromethyl)cyclohexyl]hexan-2-yl]-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCCCOC(C)OC1(C(F)(F)F)CCC(C(CC)CC(C)C23CCC(C2)C(C(O)(C(F)(F)F)C(F)(F)F)C3)CC1 |
| InChI | InChI=1S/C29H45F9O3/c1-5-7-14-40-19(4)41-25(27(30,31)32)12-9-21(10-13-25)20(6-2)15-18(3)24-11-8-22(16-24)23(17-24)26(39,28(33,34)35)29(36,37)38/h18-23,39H,5-17H2,1-4H3 |
| InChIKey | MBGIPFAIXWKIOV-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|