C10H12F6O — CID 23405517
3-ethenyl-5,5-dimethyl-2,2-bis(trifluoromethyl)oxolane (PubChem CID 23405517) has the molecular formula C10H12F6O and a molecular weight of 262.19 g/mol. Its IUPAC name is 3-ethenyl-5,5-dimethyl-2,2-bis(trifluoromethyl)oxolane.
| Compound Name | 3-ethenyl-5,5-dimethyl-2,2-bis(trifluoromethyl)oxolane |
|---|---|
| PubChem CID | 23405517 |
| Molecular Formula | C10H12F6O |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-ethenyl-5,5-dimethyl-2,2-bis(trifluoromethyl)oxolane |
| SMILES | C=CC1CC(C)(C)OC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F6O/c1-4-6-5-7(2,3)17-8(6,9(11,12)13)10(14,15)16/h4,6H,1,5H2,2-3H3 |
| InChIKey | CTWGOQABZKGVST-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|